C15H23N3O3S2 — CID 9284008
1-(dimethylamino)-1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 9284008) has the molecular formula C15H23N3O3S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-(dimethylamino)-1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-(dimethylamino)-1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 9284008 |
| Molecular Formula | C15H23N3O3S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-(dimethylamino)-1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)N([C@H]2CCS(=O)(=O)C2)N(C)C)cc1 |
| InChI | InChI=1S/C15H23N3O3S2/c1-17(2)18(13-8-9-23(19,20)11-13)15(22)16-10-12-4-6-14(21-3)7-5-12/h4-7,13H,8-11H2,1-3H3,(H,16,22)/t13-/m0/s1 |
| InChIKey | YZSRXJSJRNWHPO-ZDUSSCGKSA-N |
| XLogP | 1.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|