C12H14N2O5S — CID 61182882
2-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzoic acid (PubChem CID 61182882) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzoic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 61182882 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14N2O5S/c15-11(16)9-3-1-2-4-10(9)14-12(17)13-8-5-6-20(18,19)7-8/h1-4,8H,5-7H2,(H,15,16)(H2,13,14,17) |
| InChIKey | CFQHITSWHRZXEX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |