C13H16N2O5S — CID 61181828
2-[(1,1-dioxothiolan-3-yl)carbamoyl-methylamino]benzoic acid (PubChem CID 61181828) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)carbamoyl-methylamino]benzoic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)carbamoyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 61181828 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)carbamoyl-methylamino]benzoic acid |
| SMILES | CN(C(=O)NC1CCS(=O)(=O)C1)c1ccccc1C(=O)O |
| InChI | InChI=1S/C13H16N2O5S/c1-15(11-5-3-2-4-10(11)12(16)17)13(18)14-9-6-7-21(19,20)8-9/h2-5,9H,6-8H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | PGLXNMZHASVLLI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |