C13H15NO6S — CID 43214296
2-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]benzoic acid (PubChem CID 43214296) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]benzoic acid.
| Compound Name | 2-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 43214296 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]benzoic acid |
| SMILES | O=C(COc1ccccc1C(=O)O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15NO6S/c15-12(14-9-5-6-21(18,19)8-9)7-20-11-4-2-1-3-10(11)13(16)17/h1-4,9H,5-8H2,(H,14,15)(H,16,17) |
| InChIKey | PNRPWTQCFCHIDE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |