About 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid
2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid (PubChem CID 81499172) has the molecular formula C12H13FN2O5S
and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid.
Molecular Properties
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid |
| PubChem CID | 81499172 |
| Molecular Formula | C12H13FN2O5S |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid |
| SMILES | O=C(Nc1c(F)cccc1C(=O)O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13FN2O5S/c13-9-3-1-2-8(11(16)17)10(9)15-12(18)14-7-4-5-21(19,20)6-7/h1-3,7H,4-6H2,(H,16,17)(H2,14,15,18) |
| InChIKey | LQZLXJREQFYTAH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid?
The IUPAC name of 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid (CID 81499172) is 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid.
What is the SMILES notation for 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid?
The canonical SMILES for 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid is O=C(Nc1c(F)cccc1C(=O)O)NC1CCS(=O)(=O)C1.
What is the InChIKey of 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid?
The InChIKey is LQZLXJREQFYTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O5S/c13-9-3-1-2-8(11(16)17)10(9)15-12(18)14-7-4-5-21(19,20)6-7/h1-3,7H,4-6H2,(H,16,17)(H2,14,15,18).
What are the key properties of 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid?
2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid has a molecular weight of 316.31 g/mol, XLogP of 0.83, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-fluorobenzoic acid is sourced from PubChem (CID 81499172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).