C14H18F2N2O — CID 47132653
1-cycloheptyl-3-(2,6-difluorophenyl)urea (PubChem CID 47132653) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-cycloheptyl-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-cycloheptyl-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 47132653 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-cycloheptyl-3-(2,6-difluorophenyl)urea |
| SMILES | O=C(Nc1c(F)cccc1F)NC1CCCCCC1 |
| InChI | InChI=1S/C14H18F2N2O/c15-11-8-5-9-12(16)13(11)18-14(19)17-10-6-3-1-2-4-7-10/h5,8-10H,1-4,6-7H2,(H2,17,18,19) |
| InChIKey | UKXCSBUCKYZFQK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |