C15H19F2N3O — CID 86986878
1-(1-cyclopropylpiperidin-4-yl)-3-(2,6-difluorophenyl)urea (PubChem CID 86986878) has the molecular formula C15H19F2N3O and a molecular weight of 295.33 g/mol. Its IUPAC name is 1-(1-cyclopropylpiperidin-4-yl)-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-(1-cyclopropylpiperidin-4-yl)-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 86986878 |
| Molecular Formula | C15H19F2N3O |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-(1-cyclopropylpiperidin-4-yl)-3-(2,6-difluorophenyl)urea |
| SMILES | O=C(Nc1c(F)cccc1F)NC1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C15H19F2N3O/c16-12-2-1-3-13(17)14(12)19-15(21)18-10-6-8-20(9-7-10)11-4-5-11/h1-3,10-11H,4-9H2,(H2,18,19,21) |
| InChIKey | BSMACDAKDXOKSL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |