C17H20F2N2O2 — CID 109132549
2-N-cyclohexyl-1-N-(2,6-difluorophenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109132549) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.35 g/mol. Its IUPAC name is 2-N-cyclohexyl-1-N-(2,6-difluorophenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-cyclohexyl-1-N-(2,6-difluorophenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132549 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-N-cyclohexyl-1-N-(2,6-difluorophenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)C1CC1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H20F2N2O2/c18-13-7-4-8-14(19)15(13)21-17(23)12-9-11(12)16(22)20-10-5-2-1-3-6-10/h4,7-8,10-12H,1-3,5-6,9H2,(H,20,22)(H,21,23) |
| InChIKey | ZFLNSYLDIOYNFL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |