C10H10F2N2O — CID 82235722
2-amino-N-(2,6-difluorophenyl)cyclopropane-1-carboxamide (PubChem CID 82235722) has the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-amino-N-(2,6-difluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2-amino-N-(2,6-difluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 82235722 |
| Molecular Formula | C10H10F2N2O |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-amino-N-(2,6-difluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC1CC1C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C10H10F2N2O/c11-6-2-1-3-7(12)9(6)14-10(15)5-4-8(5)13/h1-3,5,8H,4,13H2,(H,14,15) |
| InChIKey | JQZYUZOOBBXYLU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |