C17H11F5N2O2 — CID 109144245
1-N-(2,6-difluorophenyl)-2-N-(2,3,4-trifluorophenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109144245) has the molecular formula C17H11F5N2O2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 1-N-(2,6-difluorophenyl)-2-N-(2,3,4-trifluorophenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(2,6-difluorophenyl)-2-N-(2,3,4-trifluorophenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109144245 |
| Molecular Formula | C17H11F5N2O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-N-(2,6-difluorophenyl)-2-N-(2,3,4-trifluorophenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CC1C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C17H11F5N2O2/c18-9-4-5-12(14(22)13(9)21)23-16(25)7-6-8(7)17(26)24-15-10(19)2-1-3-11(15)20/h1-5,7-8H,6H2,(H,23,25)(H,24,26) |
| InChIKey | RDEBRGBUINNHSV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|