C18H21F3N2O2 — CID 109139804
2-N-cycloheptyl-1-N-(2,3,4-trifluorophenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109139804) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-N-cycloheptyl-1-N-(2,3,4-trifluorophenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-cycloheptyl-1-N-(2,3,4-trifluorophenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109139804 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-N-cycloheptyl-1-N-(2,3,4-trifluorophenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CC1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C18H21F3N2O2/c19-13-7-8-14(16(21)15(13)20)23-18(25)12-9-11(12)17(24)22-10-5-3-1-2-4-6-10/h7-8,10-12H,1-6,9H2,(H,22,24)(H,23,25) |
| InChIKey | MZPXZNJGKNVTHT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|