C14H15N3O3S — CID 47032833
1-(1,1-dioxothiolan-3-yl)-3-quinolin-8-ylurea (PubChem CID 47032833) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-quinolin-8-ylurea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-quinolin-8-ylurea |
|---|---|
| PubChem CID | 47032833 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-quinolin-8-ylurea |
| SMILES | O=C(Nc1cccc2cccnc12)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H15N3O3S/c18-14(16-11-6-8-21(19,20)9-11)17-12-5-1-3-10-4-2-7-15-13(10)12/h1-5,7,11H,6,8-9H2,(H2,16,17,18) |
| InChIKey | QJSBCTCKOJYDHB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |