C17H17N5O2S — CID 112895930
4-N-(1,1-dioxothiolan-3-yl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine (PubChem CID 112895930) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112895930 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine |
| SMILES | O=S1(=O)CCC(Nc2ccnc(Nc3cccc4cccnc34)n2)C1 |
| InChI | InChI=1S/C17H17N5O2S/c23-25(24)10-7-13(11-25)20-15-6-9-19-17(22-15)21-14-5-1-3-12-4-2-8-18-16(12)14/h1-6,8-9,13H,7,10-11H2,(H2,19,20,21,22) |
| InChIKey | HSQRXMHRMZSZNT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |