C18H21N3O4S — CID 113121709
3-[acetyl-(1,1-dioxothiolan-3-yl)amino]-N-quinolin-8-ylpropanamide (PubChem CID 113121709) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 3-[acetyl-(1,1-dioxothiolan-3-yl)amino]-N-quinolin-8-ylpropanamide.
| Compound Name | 3-[acetyl-(1,1-dioxothiolan-3-yl)amino]-N-quinolin-8-ylpropanamide |
|---|---|
| PubChem CID | 113121709 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-[acetyl-(1,1-dioxothiolan-3-yl)amino]-N-quinolin-8-ylpropanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1cccc2cccnc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H21N3O4S/c1-13(22)21(15-8-11-26(24,25)12-15)10-7-17(23)20-16-6-2-4-14-5-3-9-19-18(14)16/h2-6,9,15H,7-8,10-12H2,1H3,(H,20,23) |
| InChIKey | JWOMVIMQNRXPTG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |