C18H17BrN2O4S — CID 95574617
2-[(2-bromobenzoyl)amino]-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 95574617) has the molecular formula C18H17BrN2O4S and a molecular weight of 437.32 g/mol. Its IUPAC name is 2-[(2-bromobenzoyl)amino]-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 2-[(2-bromobenzoyl)amino]-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 95574617 |
| Molecular Formula | C18H17BrN2O4S |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 2-[(2-bromobenzoyl)amino]-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)N[C@H]1CCS(=O)(=O)C1)c1ccccc1Br |
| InChI | InChI=1S/C18H17BrN2O4S/c19-15-7-3-1-5-13(15)17(22)21-16-8-4-2-6-14(16)18(23)20-12-9-10-26(24,25)11-12/h1-8,12H,9-11H2,(H,20,23)(H,21,22)/t12-/m0/s1 |
| InChIKey | OVZXRXSEZBVVBG-LBPRGKRZSA-N |
| XLogP | 2.62 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |