C11H12BrNO3S2 — CID 107020744
2-bromo-N-(1,1-dioxothiolan-3-yl)-5-sulfanylbenzamide (PubChem CID 107020744) has the molecular formula C11H12BrNO3S2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 2-bromo-N-(1,1-dioxothiolan-3-yl)-5-sulfanylbenzamide.
| Compound Name | 2-bromo-N-(1,1-dioxothiolan-3-yl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107020744 |
| Molecular Formula | C11H12BrNO3S2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | 2-bromo-N-(1,1-dioxothiolan-3-yl)-5-sulfanylbenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc(S)ccc1Br |
| InChI | InChI=1S/C11H12BrNO3S2/c12-10-2-1-8(17)5-9(10)11(14)13-7-3-4-18(15,16)6-7/h1-2,5,7,17H,3-4,6H2,(H,13,14) |
| InChIKey | ULYOTKYUUWCWBB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|