C12H14FNO3S2 — CID 107030226
N-(1,1-dioxothian-3-yl)-2-fluoro-5-sulfanylbenzamide (PubChem CID 107030226) has the molecular formula C12H14FNO3S2 and a molecular weight of 303.38 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-2-fluoro-5-sulfanylbenzamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-2-fluoro-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107030226 |
| Molecular Formula | C12H14FNO3S2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-2-fluoro-5-sulfanylbenzamide |
| SMILES | O=C(NC1CCCS(=O)(=O)C1)c1cc(S)ccc1F |
| InChI | InChI=1S/C12H14FNO3S2/c13-11-4-3-9(18)6-10(11)12(15)14-8-2-1-5-19(16,17)7-8/h3-4,6,8,18H,1-2,5,7H2,(H,14,15) |
| InChIKey | LLQVSGIHZFHOBD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|