C12H15NO5S — CID 107723081
N-(1,1-dioxothian-3-yl)-2,5-dihydroxybenzamide (PubChem CID 107723081) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-2,5-dihydroxybenzamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107723081 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-2,5-dihydroxybenzamide |
| SMILES | O=C(NC1CCCS(=O)(=O)C1)c1cc(O)ccc1O |
| InChI | InChI=1S/C12H15NO5S/c14-9-3-4-11(15)10(6-9)12(16)13-8-2-1-5-19(17,18)7-8/h3-4,6,8,14-15H,1-2,5,7H2,(H,13,16) |
| InChIKey | CZUDMQONOQYHTB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|