C13H18N2O3S — CID 63924859
4-amino-N-(1,1-dioxothian-3-yl)-2-methylbenzamide (PubChem CID 63924859) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-amino-N-(1,1-dioxothian-3-yl)-2-methylbenzamide.
| Compound Name | 4-amino-N-(1,1-dioxothian-3-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 63924859 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-amino-N-(1,1-dioxothian-3-yl)-2-methylbenzamide |
| SMILES | Cc1cc(N)ccc1C(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N2O3S/c1-9-7-10(14)4-5-12(9)13(16)15-11-3-2-6-19(17,18)8-11/h4-5,7,11H,2-3,6,8,14H2,1H3,(H,15,16) |
| InChIKey | XVKXSYDZOXAVHQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|