C13H18N2O3S — CID 102704893
5-amino-N-(1,1-dioxothiolan-3-yl)-2,4-dimethylbenzamide (PubChem CID 102704893) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 5-amino-N-(1,1-dioxothiolan-3-yl)-2,4-dimethylbenzamide.
| Compound Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 102704893 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NC2CCS(=O)(=O)C2)cc1N |
| InChI | InChI=1S/C13H18N2O3S/c1-8-5-9(2)12(14)6-11(8)13(16)15-10-3-4-19(17,18)7-10/h5-6,10H,3-4,7,14H2,1-2H3,(H,15,16) |
| InChIKey | JOHIXDMONSZJSM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|