C12H18N2O3S — CID 110691263
N-(1,1-dioxothiolan-3-yl)-1,2,5-trimethylpyrrole-3-carboxamide (PubChem CID 110691263) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1,2,5-trimethylpyrrole-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1,2,5-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 110691263 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1,2,5-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCS(=O)(=O)C2)c(C)n1C |
| InChI | InChI=1S/C12H18N2O3S/c1-8-6-11(9(2)14(8)3)12(15)13-10-4-5-18(16,17)7-10/h6,10H,4-5,7H2,1-3H3,(H,13,15) |
| InChIKey | BHWQPEYKLBIMHN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |