C19H22N2O5S — CID 42949159
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 42949159) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 42949159 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCS(=O)(=O)C2)c(C)n1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H22N2O5S/c1-12-9-16(19(22)20-14-5-8-27(23,24)11-14)13(2)21(12)15-3-4-17-18(10-15)26-7-6-25-17/h3-4,9-10,14H,5-8,11H2,1-2H3,(H,20,22) |
| InChIKey | WBOGOHLAMSTBJY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|