C27H29N3O4 — CID 55992219
N-[4-(cyclopentylcarbamoyl)phenyl]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55992219) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[4-(cyclopentylcarbamoyl)phenyl]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-[4-(cyclopentylcarbamoyl)phenyl]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55992219 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-[4-(cyclopentylcarbamoyl)phenyl]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(=O)NC3CCCC3)cc2)c(C)n1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C27H29N3O4/c1-17-15-23(18(2)30(17)22-11-12-24-25(16-22)34-14-13-33-24)27(32)29-21-9-7-19(8-10-21)26(31)28-20-5-3-4-6-20/h7-12,15-16,20H,3-6,13-14H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | JWMPBQYYYNCFTQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|