C18H17N3O3S — CID 52714198
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethyl-N-(1,3-thiazol-2-yl)pyrrole-3-carboxamide (PubChem CID 52714198) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethyl-N-(1,3-thiazol-2-yl)pyrrole-3-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethyl-N-(1,3-thiazol-2-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 52714198 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethyl-N-(1,3-thiazol-2-yl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nccs2)c(C)n1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H17N3O3S/c1-11-9-14(17(22)20-18-19-5-8-25-18)12(2)21(11)13-3-4-15-16(10-13)24-7-6-23-15/h3-5,8-10H,6-7H2,1-2H3,(H,19,20,22) |
| InChIKey | HNCSVSURJQGLOE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|