C16H14BrN3OS — CID 52708985
1-(3-bromophenyl)-2,5-dimethyl-N-(1,3-thiazol-2-yl)pyrrole-3-carboxamide (PubChem CID 52708985) has the molecular formula C16H14BrN3OS and a molecular weight of 376.28 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,5-dimethyl-N-(1,3-thiazol-2-yl)pyrrole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-2,5-dimethyl-N-(1,3-thiazol-2-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 52708985 |
| Molecular Formula | C16H14BrN3OS |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 1-(3-bromophenyl)-2,5-dimethyl-N-(1,3-thiazol-2-yl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nccs2)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C16H14BrN3OS/c1-10-8-14(15(21)19-16-18-6-7-22-16)11(2)20(10)13-5-3-4-12(17)9-13/h3-9H,1-2H3,(H,18,19,21) |
| InChIKey | KWNUFIKEQLDGDR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|