C16H12BrF3N4OS — CID 52725726
1-(3-bromophenyl)-2,5-dimethyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]pyrrole-3-carboxamide (PubChem CID 52725726) has the molecular formula C16H12BrF3N4OS and a molecular weight of 445.26 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,5-dimethyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]pyrrole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-2,5-dimethyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 52725726 |
| Molecular Formula | C16H12BrF3N4OS |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | 1-(3-bromophenyl)-2,5-dimethyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nnc(C(F)(F)F)s2)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C16H12BrF3N4OS/c1-8-6-12(9(2)24(8)11-5-3-4-10(17)7-11)13(25)21-15-23-22-14(26-15)16(18,19)20/h3-7H,1-2H3,(H,21,23,25) |
| InChIKey | MTWLXUATPKEXIP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|