C20H17BrFN3O2 — CID 55912306
1-(3-bromophenyl)-N-(3-carbamoyl-4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55912306) has the molecular formula C20H17BrFN3O2 and a molecular weight of 430.28 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(3-carbamoyl-4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-(3-carbamoyl-4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55912306 |
| Molecular Formula | C20H17BrFN3O2 |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-(3-bromophenyl)-N-(3-carbamoyl-4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(F)c(C(N)=O)c2)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C20H17BrFN3O2/c1-11-8-16(12(2)25(11)15-5-3-4-13(21)9-15)20(27)24-14-6-7-18(22)17(10-14)19(23)26/h3-10H,1-2H3,(H2,23,26)(H,24,27) |
| InChIKey | VFXWVQOEMGUGNC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|