C22H22BrN5O2 — CID 60544873
1-(3-bromophenyl)-2,5-dimethyl-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyrrole-3-carboxamide (PubChem CID 60544873) has the molecular formula C22H22BrN5O2 and a molecular weight of 468.36 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,5-dimethyl-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyrrole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-2,5-dimethyl-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 60544873 |
| Molecular Formula | C22H22BrN5O2 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 1-(3-bromophenyl)-2,5-dimethyl-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N3CCNC(=O)C3)nc2)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C22H22BrN5O2/c1-14-10-19(15(2)28(14)18-5-3-4-16(23)11-18)22(30)26-17-6-7-20(25-12-17)27-9-8-24-21(29)13-27/h3-7,10-12H,8-9,13H2,1-2H3,(H,24,29)(H,26,30) |
| InChIKey | LEPLOEFSJCFOFB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|