C19H17FN6O2 — CID 38940282
5-(4-fluorophenyl)-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]-1H-pyrazole-4-carboxamide (PubChem CID 38940282) has the molecular formula C19H17FN6O2 and a molecular weight of 380.38 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 38940282 |
| Molecular Formula | C19H17FN6O2 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3cn[nH]c3-c3ccc(F)cc3)cn2)CCN1 |
| InChI | InChI=1S/C19H17FN6O2/c20-13-3-1-12(2-4-13)18-15(10-23-25-18)19(28)24-14-5-6-16(22-9-14)26-8-7-21-17(27)11-26/h1-6,9-10H,7-8,11H2,(H,21,27)(H,23,25)(H,24,28) |
| InChIKey | FSLVHMKAGUWJEU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |