C16H17N5O3 — CID 38940028
2-methoxy-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyridine-3-carboxamide (PubChem CID 38940028) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-methoxy-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyridine-3-carboxamide.
| Compound Name | 2-methoxy-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 38940028 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-methoxy-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)Nc1ccc(N2CCNC(=O)C2)nc1 |
| InChI | InChI=1S/C16H17N5O3/c1-24-16-12(3-2-6-18-16)15(23)20-11-4-5-13(19-9-11)21-8-7-17-14(22)10-21/h2-6,9H,7-8,10H2,1H3,(H,17,22)(H,20,23) |
| InChIKey | PLXLEEZYFWWMJB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |