C20H16BrF2N3O2 — CID 56572905
1-(4-bromophenyl)-N-(5-carbamoyl-2,4-difluorophenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 56572905) has the molecular formula C20H16BrF2N3O2 and a molecular weight of 448.27 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-(5-carbamoyl-2,4-difluorophenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-(5-carbamoyl-2,4-difluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 56572905 |
| Molecular Formula | C20H16BrF2N3O2 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 1-(4-bromophenyl)-N-(5-carbamoyl-2,4-difluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(C(N)=O)c(F)cc2F)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrF2N3O2/c1-10-7-14(11(2)26(10)13-5-3-12(21)4-6-13)20(28)25-18-8-15(19(24)27)16(22)9-17(18)23/h3-9H,1-2H3,(H2,24,27)(H,25,28) |
| InChIKey | NXRQVOVXMDRMJL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|