C24H24BrN3O2 — CID 55964791
1-(4-bromophenyl)-N-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55964791) has the molecular formula C24H24BrN3O2 and a molecular weight of 466.38 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55964791 |
| Molecular Formula | C24H24BrN3O2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 1-(4-bromophenyl)-N-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1NC(=O)c1cc(C)n(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C24H24BrN3O2/c1-14-4-5-17(23(29)26-19-8-9-19)13-22(14)27-24(30)21-12-15(2)28(16(21)3)20-10-6-18(25)7-11-20/h4-7,10-13,19H,8-9H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | DMPMLIPGLBNWLG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|