C20H22BrN3O2 — CID 91646526
3-[(4-bromobenzoyl)amino]-4-methyl-N-[(3S)-piperidin-3-yl]benzamide (PubChem CID 91646526) has the molecular formula C20H22BrN3O2 and a molecular weight of 416.32 g/mol. Its IUPAC name is 3-[(4-bromobenzoyl)amino]-4-methyl-N-[(3S)-piperidin-3-yl]benzamide.
| Compound Name | 3-[(4-bromobenzoyl)amino]-4-methyl-N-[(3S)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 91646526 |
| Molecular Formula | C20H22BrN3O2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 3-[(4-bromobenzoyl)amino]-4-methyl-N-[(3S)-piperidin-3-yl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CCCNC2)cc1NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H22BrN3O2/c1-13-4-5-15(20(26)23-17-3-2-10-22-12-17)11-18(13)24-19(25)14-6-8-16(21)9-7-14/h4-9,11,17,22H,2-3,10,12H2,1H3,(H,23,26)(H,24,25)/t17-/m0/s1 |
| InChIKey | WUCWGFLKQNDFPJ-KRWDZBQOSA-N |
| XLogP | 3.49 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |