C17H20BrN3O — CID 119453825
1-(4-bromophenyl)-2,5-dimethyl-N-pyrrolidin-3-ylpyrrole-3-carboxamide (PubChem CID 119453825) has the molecular formula C17H20BrN3O and a molecular weight of 362.27 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,5-dimethyl-N-pyrrolidin-3-ylpyrrole-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)-2,5-dimethyl-N-pyrrolidin-3-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 119453825 |
| Molecular Formula | C17H20BrN3O |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1-(4-bromophenyl)-2,5-dimethyl-N-pyrrolidin-3-ylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCNC2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H20BrN3O/c1-11-9-16(17(22)20-14-7-8-19-10-14)12(2)21(11)15-5-3-13(18)4-6-15/h3-6,9,14,19H,7-8,10H2,1-2H3,(H,20,22) |
| InChIKey | CEFXVHDUTHFIHF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|