C19H24ClN3O — CID 120602268
1-(4-chlorophenyl)-2,5-dimethyl-N-(2-methylpiperidin-4-yl)pyrrole-3-carboxamide (PubChem CID 120602268) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,5-dimethyl-N-(2-methylpiperidin-4-yl)pyrrole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-(2-methylpiperidin-4-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 120602268 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-(2-methylpiperidin-4-yl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCNC(C)C2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN3O/c1-12-10-16(8-9-21-12)22-19(24)18-11-13(2)23(14(18)3)17-6-4-15(20)5-7-17/h4-7,11-12,16,21H,8-10H2,1-3H3,(H,22,24) |
| InChIKey | QIODHIMCYHQGCT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|