C23H31ClN4O2 — CID 52711859
1-(4-chlorophenyl)-2,5-dimethyl-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]pyrrole-3-carboxamide (PubChem CID 52711859) has the molecular formula C23H31ClN4O2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,5-dimethyl-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 52711859 |
| Molecular Formula | C23H31ClN4O2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]pyrrole-3-carboxamide |
| SMILES | CCCNC(=O)CN1CCC(NC(=O)c2cc(C)n(-c3ccc(Cl)cc3)c2C)CC1 |
| InChI | InChI=1S/C23H31ClN4O2/c1-4-11-25-22(29)15-27-12-9-19(10-13-27)26-23(30)21-14-16(2)28(17(21)3)20-7-5-18(24)6-8-20/h5-8,14,19H,4,9-13,15H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | HFXLYIHTOOEJIC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|