C22H29N3O3 — CID 7708936
ethyl 4-[[2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 7708936) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 4-[[2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 7708936 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethyl 4-[[2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cc(C)n(-c3ccc(C)cc3)c2C)CC1 |
| InChI | InChI=1S/C22H29N3O3/c1-5-28-22(27)24-12-10-18(11-13-24)23-21(26)20-14-16(3)25(17(20)4)19-8-6-15(2)7-9-19/h6-9,14,18H,5,10-13H2,1-4H3,(H,23,26) |
| InChIKey | MYRDZQWKLQFIJJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|