C22H21FN6O2 — CID 56532813
N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 56532813) has the molecular formula C22H21FN6O2 and a molecular weight of 420.45 g/mol. Its IUPAC name is N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 56532813 |
| Molecular Formula | C22H21FN6O2 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)Nc3cc(-n4nnnc4C)ccc3F)c2C)cc1 |
| InChI | InChI=1S/C22H21FN6O2/c1-13-11-19(14(2)28(13)16-5-8-18(31-4)9-6-16)22(30)24-21-12-17(7-10-20(21)23)29-15(3)25-26-27-29/h5-12H,1-4H3,(H,24,30) |
| InChIKey | BAQQARUOBAQACC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|