C27H30N4O4 — CID 55933864
1-[2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoyl]piperidine-4-carboxamide (PubChem CID 55933864) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 1-[2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55933864 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1-[2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)Nc3ccccc3C(=O)N3CCC(C(N)=O)CC3)c2C)cc1 |
| InChI | InChI=1S/C27H30N4O4/c1-17-16-23(18(2)31(17)20-8-10-21(35-3)11-9-20)26(33)29-24-7-5-4-6-22(24)27(34)30-14-12-19(13-15-30)25(28)32/h4-11,16,19H,12-15H2,1-3H3,(H2,28,32)(H,29,33) |
| InChIKey | JUYNFWYYAMEQSZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|