C28H29N3O5 — CID 55642413
1-[2-[(3-methoxy-4-phenylmethoxybenzoyl)amino]benzoyl]piperidine-4-carboxamide (PubChem CID 55642413) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is 1-[2-[(3-methoxy-4-phenylmethoxybenzoyl)amino]benzoyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[(3-methoxy-4-phenylmethoxybenzoyl)amino]benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55642413 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 1-[2-[(3-methoxy-4-phenylmethoxybenzoyl)amino]benzoyl]piperidine-4-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)N2CCC(C(N)=O)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H29N3O5/c1-35-25-17-21(11-12-24(25)36-18-19-7-3-2-4-8-19)27(33)30-23-10-6-5-9-22(23)28(34)31-15-13-20(14-16-31)26(29)32/h2-12,17,20H,13-16,18H2,1H3,(H2,29,32)(H,30,33) |
| InChIKey | MASPZVLBOUEMCD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |