C16H18N2O4 — CID 119171465
2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]acetic acid (PubChem CID 119171465) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 119171465 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]acetic acid |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)NCC(=O)O)c2C)cc1 |
| InChI | InChI=1S/C16H18N2O4/c1-10-8-14(16(21)17-9-15(19)20)11(2)18(10)12-4-6-13(22-3)7-5-12/h4-8H,9H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | UJANTHSBFPMKKJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|