C21H26N2O5 — CID 120541842
4-[[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]methyl]oxane-4-carboxylic acid (PubChem CID 120541842) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-[[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120541842 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-[[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]methyl]oxane-4-carboxylic acid |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)NCC3(C(=O)O)CCOCC3)c2C)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-14-12-18(15(2)23(14)16-4-6-17(27-3)7-5-16)19(24)22-13-21(20(25)26)8-10-28-11-9-21/h4-7,12H,8-11,13H2,1-3H3,(H,22,24)(H,25,26) |
| InChIKey | LMMUMDCUMUNNEG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|