C22H22N2O4 — CID 60599272
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 60599272) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 60599272 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)Nc3ccc4c(c3)OCCO4)c2C)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-14-12-19(15(2)24(14)17-5-7-18(26-3)8-6-17)22(25)23-16-4-9-20-21(13-16)28-11-10-27-20/h4-9,12-13H,10-11H2,1-3H3,(H,23,25) |
| InChIKey | ZUIXECMLAXGRFB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|