C24H24N4O2 — CID 24617865
1-(4-methoxyphenyl)-2,5-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]pyrrole-3-carboxamide (PubChem CID 24617865) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,5-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-2,5-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 24617865 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,5-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]pyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)NCc3cnn(-c4ccccc4)c3)c2C)cc1 |
| InChI | InChI=1S/C24H24N4O2/c1-17-13-23(18(2)28(17)21-9-11-22(30-3)12-10-21)24(29)25-14-19-15-26-27(16-19)20-7-5-4-6-8-20/h4-13,15-16H,14H2,1-3H3,(H,25,29) |
| InChIKey | FDZVHGGFZDEQAF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|