C28H25N5O2 — CID 42034029
1-benzyl-3-(4-methoxyphenyl)-N-[(1-phenylpyrazol-4-yl)methyl]pyrazole-4-carboxamide (PubChem CID 42034029) has the molecular formula C28H25N5O2 and a molecular weight of 463.54 g/mol. Its IUPAC name is 1-benzyl-3-(4-methoxyphenyl)-N-[(1-phenylpyrazol-4-yl)methyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-3-(4-methoxyphenyl)-N-[(1-phenylpyrazol-4-yl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 42034029 |
| Molecular Formula | C28H25N5O2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 1-benzyl-3-(4-methoxyphenyl)-N-[(1-phenylpyrazol-4-yl)methyl]pyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2nn(Cc3ccccc3)cc2C(=O)NCc2cnn(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H25N5O2/c1-35-25-14-12-23(13-15-25)27-26(20-32(31-27)18-21-8-4-2-5-9-21)28(34)29-16-22-17-30-33(19-22)24-10-6-3-7-11-24/h2-15,17,19-20H,16,18H2,1H3,(H,29,34) |
| InChIKey | GTQBCOYIEOHZPG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |