C23H26N4O4 — CID 56557916
ethyl N-[2-[[1-benzyl-3-(4-methoxyphenyl)pyrazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 56557916) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is ethyl N-[2-[[1-benzyl-3-(4-methoxyphenyl)pyrazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[1-benzyl-3-(4-methoxyphenyl)pyrazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56557916 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | ethyl N-[2-[[1-benzyl-3-(4-methoxyphenyl)pyrazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)c1cn(Cc2ccccc2)nc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-3-31-23(29)25-14-13-24-22(28)20-16-27(15-17-7-5-4-6-8-17)26-21(20)18-9-11-19(30-2)12-10-18/h4-12,16H,3,13-15H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | PKFHBXQHNREUKP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|