C22H24N2O4S — CID 55961916
1-(4-methoxyphenyl)-2,5-dimethyl-N-[(4-methylsulfonylphenyl)methyl]pyrrole-3-carboxamide (PubChem CID 55961916) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,5-dimethyl-N-[(4-methylsulfonylphenyl)methyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-2,5-dimethyl-N-[(4-methylsulfonylphenyl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55961916 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,5-dimethyl-N-[(4-methylsulfonylphenyl)methyl]pyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)NCc3ccc(S(C)(=O)=O)cc3)c2C)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-15-13-21(16(2)24(15)18-7-9-19(28-3)10-8-18)22(25)23-14-17-5-11-20(12-6-17)29(4,26)27/h5-13H,14H2,1-4H3,(H,23,25) |
| InChIKey | XYIQLBKIHUNBHZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|