C22H22F3N3O4S — CID 24560064
1-(4-methoxyphenyl)-2,5-dimethyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]pyrrole-3-carboxamide (PubChem CID 24560064) has the molecular formula C22H22F3N3O4S and a molecular weight of 481.50 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,5-dimethyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-2,5-dimethyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 24560064 |
| Molecular Formula | C22H22F3N3O4S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,5-dimethyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]pyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)Nc3ccc(S(=O)(=O)NCC(F)(F)F)cc3)c2C)cc1 |
| InChI | InChI=1S/C22H22F3N3O4S/c1-14-12-20(15(2)28(14)17-6-8-18(32-3)9-7-17)21(29)27-16-4-10-19(11-5-16)33(30,31)26-13-22(23,24)25/h4-12,26H,13H2,1-3H3,(H,27,29) |
| InChIKey | QVXRIDSJLZFQCS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|