C19H24N2O5 — CID 120703120
4-methoxy-2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]butanoic acid (PubChem CID 120703120) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-methoxy-2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]butanoic acid.
| Compound Name | 4-methoxy-2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120703120 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-methoxy-2-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]butanoic acid |
| SMILES | COCCC(NC(=O)c1cc(C)n(-c2ccc(OC)cc2)c1C)C(=O)O |
| InChI | InChI=1S/C19H24N2O5/c1-12-11-16(18(22)20-17(19(23)24)9-10-25-3)13(2)21(12)14-5-7-15(26-4)8-6-14/h5-8,11,17H,9-10H2,1-4H3,(H,20,22)(H,23,24) |
| InChIKey | MSXZVEHUDLHDQI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|