C14H19NO6 — CID 81085345
2-[(2-hydroxy-4-methoxybenzoyl)amino]-5-methoxypentanoic acid (PubChem CID 81085345) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[(2-hydroxy-4-methoxybenzoyl)amino]-5-methoxypentanoic acid.
| Compound Name | 2-[(2-hydroxy-4-methoxybenzoyl)amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81085345 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[(2-hydroxy-4-methoxybenzoyl)amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)c1ccc(OC)cc1O)C(=O)O |
| InChI | InChI=1S/C14H19NO6/c1-20-7-3-4-11(14(18)19)15-13(17)10-6-5-9(21-2)8-12(10)16/h5-6,8,11,16H,3-4,7H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | OKSQWEZSXZPITF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|